Research any topic before you write.
Find related topics. | Discover entities. | See connections. | Build a topical map.
Aceton je triviální pojmenování pro propan-2-on nebo též dimethylketon. Charakteristickou skupinou je karbonyl. Aceton je bezbarvá kapalina specifického zápachu, hořlavá, s vodou neomezeně mísitelná. Směs par s kyslíkem je výbušná. Používá se jako rozpouštědlo organických látek.
Bezpečnost, Chemické vlastnosti & Využití v průmyslu
Explore the main themes, entities and connections around Aceton. Start with the topic map, then use the sections below for research and deeper semantic analysis.
Start with a few of the strongest sections from the source topic. These are research directions, not a list of keywords you must use.
High-confidence facts extracted from structured source data. Use them as anchors for further research.
Browse the full topic structure. Each item opens a new analysis centered on that subject.
Deeper signals for content research, entity SEO and topical coverage. The plain-language headings explain what each technical view is useful for.
See the strongest relationship patterns around the current topic before diving into the raw triples.
Use these terms to understand the vocabulary surrounding the topic, not as a checklist for keyword stuffing.
acetonu může jako mg účinky dimethylketon peroxidy například m3 kapalina prostředí stp páry mohou triviální propan-2-on bezbarvá rozpouštědlo zdroj kg
| Subject | Predicate | Object | Confidence | Src |
|---|---|---|---|---|
| Aceton | Anglický název | acetone | 1.00 | infobox |
| Aceton | Dipólový moment | 2,91 D | 1.00 | infobox |
| Aceton | Disociační konstanta pKa | 24,2 | 1.00 | infobox |
| Aceton | Dynamický viskozitní koeficient | 0,303 cP (25 °C) | 1.00 | infobox |
| Aceton | EC-no (EINECS/ELINCS/NLP) | 200-662-2 | 1.00 | infobox |
| Aceton | Funkční vzorec | CH3COCH3 | 1.00 | infobox |
| Aceton | H-věty | H225 H319 H336 EUH066 | 1.00 | infobox |
| Aceton | Hustota | 0,79 g/cm3 | 1.00 | infobox |
| Aceton | InChI | InChI=1/C3H6O/c1-3(2)4/h1-2H3 | 1.00 | infobox |
| Aceton | Indexové číslo | 606-001-00-8 | 1.00 | infobox |
| Aceton | Meze výbušnosti | 2,6-12,8 % objemově | 1.00 | infobox |
| Aceton | Molární hmotnost | 58,08 g/mol | 1.00 | infobox |
| Aceton | NFPA 704 | 3 1 0 | 1.00 | infobox |
| Aceton | Německý název | Aceton | 1.00 | infobox |
| Aceton | Ostatní názvy | propanon | 1.00 | infobox |
| Aceton | R-věty | R11 R36 R66 R67 | 1.00 | infobox |
| Aceton | Registrační číslo CAS | 67-64-1 | 1.00 | infobox |
| Aceton | Rozpustnost ve vodě | neomezená | 1.00 | infobox |
| Aceton | S-věty | (S2) S9 S16 S26 | 1.00 | infobox |
| Aceton | SMILES | CC(=O)C | 1.00 | infobox |
| Aceton | Sumární vzorec | C3H6O | 1.00 | infobox |
| Aceton | Systematický název | propan-2-on, dimethylketon | 1.00 | infobox |
| Aceton | Teplota tání | −94,9 °C | 1.00 | infobox |
| Aceton | Teplota varu | 56,53 °C | 1.00 | infobox |
| Aceton | Teplota vznícení | 465 °C | 1.00 | infobox |
| Aceton | Teplota vzplanutí | −17 °C | 1.00 | infobox |
| Aceton | Tlak páry | 24,23 kPa (20 °C) | 1.00 | infobox |
| Aceton | Triviální název | aceton | 1.00 | infobox |
| Aceton | Vzhled | bezbarvá kapalina | 1.00 | infobox |
| Aceton | Číslo RTECS | AL3150000 | 1.00 | infobox |
These clusters group vocabulary that occurs around closely connected concepts in the source material.
Bridges can reveal useful research angles that are easy to miss in a flat list of related terms.